CAS 191018-57-2 is the registry number for 4-(3,4-Difluorophenyl)-2-methyl-4-oxobutanoic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(3,4-difluorophenyl)-2-methyl-4-oxobutanoic acid (CAS 191018-57-2) is a chemical compound with the molecular formula C11H10F2O3 and a molecular weight of 228.19 g/mol. IUPAC name: 4-(3,4-difluorophenyl)-2-methyl-4-oxobutanoic acid. InChIKey: AULAEUGQEJLYAQ-UHFFFAOYSA-N.
| Molecular formula | C11H10F2O3 |
|---|---|
| Molecular weight | 228.19 g/mol |
| IUPAC name | 4-(3,4-difluorophenyl)-2-methyl-4-oxobutanoic acid |
| InChIKey | AULAEUGQEJLYAQ-UHFFFAOYSA-N |
| SMILES | CC(CC(=O)C1=CC(=C(C=C1)F)F)C(=O)O |
Computed by PubChem (NCBI)