CAS 1017779-43-9 is the registry number for 4-Ethoxy-3,5-difluorocinnamic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(E)-3-(4-ethoxy-3,5-difluorophenyl)prop-2-enoic acid (CAS 1017779-43-9) is a chemical compound with the molecular formula C11H10F2O3 and a molecular weight of 228.19 g/mol. IUPAC name: (E)-3-(4-ethoxy-3,5-difluorophenyl)prop-2-enoic acid. InChIKey: WBJLFLHSNKNHCG-ONEGZZNKSA-N.
| Molecular formula | C11H10F2O3 |
|---|---|
| Molecular weight | 228.19 g/mol |
| IUPAC name | (E)-3-(4-ethoxy-3,5-difluorophenyl)prop-2-enoic acid |
| InChIKey | WBJLFLHSNKNHCG-ONEGZZNKSA-N |
| SMILES | CCOC1=C(C=C(C=C1F)/C=C/C(=O)O)F |
Computed by PubChem (NCBI)