CAS 1807937-62-7 is the registry number for Rel-(1R,2R)-2-(4-(difluoromethoxy)phenyl)cyclopropane-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Trans-(1R,2R)-2-[4-(difluoromethoxy)phenyl]cyclopropane-1-carboxylic acid (CAS 1807937-62-7) is a chemical compound with the molecular formula C11H10F2O3 and a molecular weight of 228.19 g/mol. IUPAC name: trans-(1R,2R)-2-[4-(difluoromethoxy)phenyl]cyclopropane-1-carboxylic acid. InChIKey: XRVPPNOXFATEAL-DTWKUNHWSA-N.
| Molecular formula | C11H10F2O3 |
|---|---|
| Molecular weight | 228.19 g/mol |
| IUPAC name | trans-(1R,2R)-2-[4-(difluoromethoxy)phenyl]cyclopropane-1-carboxylic acid |
| InChIKey | XRVPPNOXFATEAL-DTWKUNHWSA-N |
| SMILES | C1[C@H]([C@@H]1C(=O)O)C2=CC=C(C=C2)OC(F)F |
Computed by PubChem (NCBI)