CAS 1017779-14-4 appears in our catalog under these names: 2-Methoxy-5-(trifluoromethoxy)cinnamic acid, 95%, 3-(2-Methoxy-5-(trifluoromethoxy)phenyl)acrylic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 10g.
(E)-3-[2-methoxy-5-(trifluoromethoxy)phenyl]prop-2-enoic acid (CAS 1017779-14-4) is a chemical compound with the molecular formula C11H9F3O4 and a molecular weight of 262.18 g/mol. IUPAC name: (E)-3-[2-methoxy-5-(trifluoromethoxy)phenyl]prop-2-enoic acid. InChIKey: XFIOOWSZDHARSN-GORDUTHDSA-N.
| Molecular formula | C11H9F3O4 |
|---|---|
| Molecular weight | 262.18 g/mol |
| IUPAC name | (E)-3-[2-methoxy-5-(trifluoromethoxy)phenyl]prop-2-enoic acid |
| InChIKey | XFIOOWSZDHARSN-GORDUTHDSA-N |
| SMILES | COC1=C(C=C(C=C1)OC(F)(F)F)/C=C/C(=O)O |
Computed by PubChem (NCBI)