Products 868286-79-7

CAS 868286-79-7 is the registry number for Dimethyl 5-(trifluoromethyl)benzene-1,3-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Dimethyl 5-(trifluoromethyl)benzene-1,3-dicarboxylate (CAS 868286-79-7) is a chemical compound with the molecular formula C11H9F3O4 and a molecular weight of 262.18 g/mol. IUPAC name: dimethyl 5-(trifluoromethyl)benzene-1,3-dicarboxylate. InChIKey: JIIRKRJNBBUTBR-UHFFFAOYSA-N.

Identity
Molecular formulaC11H9F3O4
Molecular weight262.18 g/mol
IUPAC namedimethyl 5-(trifluoromethyl)benzene-1,3-dicarboxylate
InChIKeyJIIRKRJNBBUTBR-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC(=CC(=C1)C(F)(F)F)C(=O)OC

Computed by PubChem (NCBI)