CAS 868286-79-7 is the registry number for Dimethyl 5-(trifluoromethyl)benzene-1,3-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Dimethyl 5-(trifluoromethyl)benzene-1,3-dicarboxylate (CAS 868286-79-7) is a chemical compound with the molecular formula C11H9F3O4 and a molecular weight of 262.18 g/mol. IUPAC name: dimethyl 5-(trifluoromethyl)benzene-1,3-dicarboxylate. InChIKey: JIIRKRJNBBUTBR-UHFFFAOYSA-N.
| Molecular formula | C11H9F3O4 |
|---|---|
| Molecular weight | 262.18 g/mol |
| IUPAC name | dimethyl 5-(trifluoromethyl)benzene-1,3-dicarboxylate |
| InChIKey | JIIRKRJNBBUTBR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC(=C1)C(F)(F)F)C(=O)OC |
Computed by PubChem (NCBI)