CAS 1162697-15-5 is the registry number for 6-(Trifluoromethoxy)chromane-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-(trifluoromethoxy)-3,4-dihydro-2H-chromene-3-carboxylic acid (CAS 1162697-15-5) is a chemical compound with the molecular formula C11H9F3O4 and a molecular weight of 262.18 g/mol. IUPAC name: 6-(trifluoromethoxy)-3,4-dihydro-2H-chromene-3-carboxylic acid. InChIKey: ZXKPRYLSFKUBOW-UHFFFAOYSA-N.
| Molecular formula | C11H9F3O4 |
|---|---|
| Molecular weight | 262.18 g/mol |
| IUPAC name | 6-(trifluoromethoxy)-3,4-dihydro-2H-chromene-3-carboxylic acid |
| InChIKey | ZXKPRYLSFKUBOW-UHFFFAOYSA-N |
| SMILES | C1C(COC2=C1C=C(C=C2)OC(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)