CAS 2643367-65-9 is the registry number for 4-(1,3-Dioxolan-2-yl)-3-(trifluoromethyl)benzoic acid, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
4-(1,3-dioxolan-2-yl)-3-(trifluoromethyl)benzoic acid (CAS 2643367-65-9) is a chemical compound with the molecular formula C11H9F3O4 and a molecular weight of 262.18 g/mol. IUPAC name: 4-(1,3-dioxolan-2-yl)-3-(trifluoromethyl)benzoic acid. InChIKey: ZJMIKLSCTACKRG-UHFFFAOYSA-N.
| Molecular formula | C11H9F3O4 |
|---|---|
| Molecular weight | 262.18 g/mol |
| IUPAC name | 4-(1,3-dioxolan-2-yl)-3-(trifluoromethyl)benzoic acid |
| InChIKey | ZJMIKLSCTACKRG-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=C(C=C(C=C2)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)