Products 2271443-05-9
CAS 2271443-05-9 is the registry number for 3-(1,3-Dioxolan-2-yl)-5-(trifluoromethyl)-benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.
3-(1,3-dioxolan-2-yl)-5-(trifluoromethyl)benzoic acid (CAS 2271443-05-9) is a chemical compound with the molecular formula C11H9F3O4 and a molecular weight of 262.18 g/mol. IUPAC name: 3-(1,3-dioxolan-2-yl)-5-(trifluoromethyl)benzoic acid. InChIKey: WUGRTQWLROWSRZ-UHFFFAOYSA-N.
| Molecular formula | C11H9F3O4 |
|---|---|
| Molecular weight | 262.18 g/mol |
| IUPAC name | 3-(1,3-dioxolan-2-yl)-5-(trifluoromethyl)benzoic acid |
| InChIKey | WUGRTQWLROWSRZ-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=CC(=CC(=C2)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)