Products 1349716-44-4

CAS 1349716-44-4 is the registry number for 4-(Oxetan-3-yloxy)-3-(trifluoromethyl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

4-(oxetan-3-yloxy)-3-(trifluoromethyl)benzoic acid (CAS 1349716-44-4) is a chemical compound with the molecular formula C11H9F3O4 and a molecular weight of 262.18 g/mol. IUPAC name: 4-(oxetan-3-yloxy)-3-(trifluoromethyl)benzoic acid. InChIKey: SUZFUXPJVLDKBM-UHFFFAOYSA-N.

Identity
Molecular formulaC11H9F3O4
Molecular weight262.18 g/mol
IUPAC name4-(oxetan-3-yloxy)-3-(trifluoromethyl)benzoic acid
InChIKeySUZFUXPJVLDKBM-UHFFFAOYSA-N
SMILESC1C(CO1)OC2=C(C=C(C=C2)C(=O)O)C(F)(F)F

Computed by PubChem (NCBI)