CAS 1017779-57-5 is the registry number for 4-Ethoxy-2,3-difluorobenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-ethoxy-2,3-difluorobenzamide (CAS 1017779-57-5) is a chemical compound with the molecular formula C9H9F2NO2 and a molecular weight of 201.17 g/mol. IUPAC name: 4-ethoxy-2,3-difluorobenzamide. InChIKey: PFXUEERRMBKGOD-UHFFFAOYSA-N.
| Molecular formula | C9H9F2NO2 |
|---|---|
| Molecular weight | 201.17 g/mol |
| IUPAC name | 4-ethoxy-2,3-difluorobenzamide |
| InChIKey | PFXUEERRMBKGOD-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C(=C(C=C1)C(=O)N)F)F |
Computed by PubChem (NCBI)