CAS 1017791-29-5 is the registry number for 4-Methyl-3-(4H-1,2,4-triazol-4-yl)aniline, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-methyl-3-(1,2,4-triazol-4-yl)aniline (CAS 1017791-29-5) is a chemical compound with the molecular formula C9H10N4 and a molecular weight of 174.20 g/mol. IUPAC name: 4-methyl-3-(1,2,4-triazol-4-yl)aniline. InChIKey: OVNPQSHIMCQHPH-UHFFFAOYSA-N.
| Molecular formula | C9H10N4 |
|---|---|
| Molecular weight | 174.20 g/mol |
| IUPAC name | 4-methyl-3-(1,2,4-triazol-4-yl)aniline |
| InChIKey | OVNPQSHIMCQHPH-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)N)N2C=NN=C2 |
Computed by PubChem (NCBI)