Products 101789-41-7
CAS 101789-41-7 is the registry number for 1,2-bis(3,5-dimethylphenyl)ethane-1,2-dione, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
1,2-bis(3,5-dimethylphenyl)ethane-1,2-dione (CAS 101789-41-7) is a chemical compound with the molecular formula C18H18O2 and a molecular weight of 266.3 g/mol. IUPAC name: 1,2-bis(3,5-dimethylphenyl)ethane-1,2-dione. InChIKey: NIFPMZQJIMISDT-UHFFFAOYSA-N.
| Molecular formula | C18H18O2 |
|---|---|
| Molecular weight | 266.3 g/mol |
| IUPAC name | 1,2-bis(3,5-dimethylphenyl)ethane-1,2-dione |
| InChIKey | NIFPMZQJIMISDT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C(=O)C(=O)C2=CC(=CC(=C2)C)C)C |
Computed by PubChem (NCBI)