CAS 1018126-69-6 is the registry number for 3-{3,4-Dimethyl-6-oxo-2-propyl-2H,6H,7H-pyrazolo(3,4-b)pyridin-7-yl}propanoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-(3,4-dimethyl-6-oxo-2-propylpyrazolo[3,4-b]pyridin-7-yl)propanoic acid (CAS 1018126-69-6) is a chemical compound with the molecular formula C14H19N3O3 and a molecular weight of 277.32 g/mol. IUPAC name: 3-(3,4-dimethyl-6-oxo-2-propylpyrazolo[3,4-b]pyridin-7-yl)propanoic acid. InChIKey: XZRNXAMFLGOAOA-UHFFFAOYSA-N.
| Molecular formula | C14H19N3O3 |
|---|---|
| Molecular weight | 277.32 g/mol |
| IUPAC name | 3-(3,4-dimethyl-6-oxo-2-propylpyrazolo[3,4-b]pyridin-7-yl)propanoic acid |
| InChIKey | XZRNXAMFLGOAOA-UHFFFAOYSA-N |
| SMILES | CCCN1C(=C2C(=CC(=O)N(C2=N1)CCC(=O)O)C)C |
Computed by PubChem (NCBI)