Products 1018170-52-9
CAS 1018170-52-9 appears in our catalog under these names: 5-(3,4-Difluorophenyl)-4,5-dihydroisoxazole-3-carboxylic acid, 97%, 5-(3,4-Difluorophenyl)-4,5-dihydro-1,2-oxazole-3-carboxylic acid, 5-(3,4-DIFLUOROPHENYL)-4,5-DIHYDROISOXAZOLE-3-CARBOXYLIC ACID, 97%, 97%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 1g, 250mg, 5g, 500mg, 2.5g, 10g.
5-(3,4-difluorophenyl)-4,5-dihydro-1,2-oxazole-3-carboxylic acid (CAS 1018170-52-9) is a chemical compound with the molecular formula C10H7F2NO3 and a molecular weight of 227.16 g/mol. IUPAC name: 5-(3,4-difluorophenyl)-4,5-dihydro-1,2-oxazole-3-carboxylic acid. InChIKey: WIFXKNNOSGOZBW-UHFFFAOYSA-N.
| Molecular formula | C10H7F2NO3 |
|---|---|
| Molecular weight | 227.16 g/mol |
| IUPAC name | 5-(3,4-difluorophenyl)-4,5-dihydro-1,2-oxazole-3-carboxylic acid |
| InChIKey | WIFXKNNOSGOZBW-UHFFFAOYSA-N |
| SMILES | C1C(ON=C1C(=O)O)C2=CC(=C(C=C2)F)F |
Computed by PubChem (NCBI)