Products 1196871-66-5
CAS 1196871-66-5 is the registry number for 2,2-Difluoro-7-nitro-3,4-dihydronaphthalen-1(2H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,2-difluoro-7-nitro-3,4-dihydronaphthalen-1-one (CAS 1196871-66-5) is a chemical compound with the molecular formula C10H7F2NO3 and a molecular weight of 227.16 g/mol. IUPAC name: 2,2-difluoro-7-nitro-3,4-dihydronaphthalen-1-one. InChIKey: COXGVUMDBFRDGB-UHFFFAOYSA-N.
| Molecular formula | C10H7F2NO3 |
|---|---|
| Molecular weight | 227.16 g/mol |
| IUPAC name | 2,2-difluoro-7-nitro-3,4-dihydronaphthalen-1-one |
| InChIKey | COXGVUMDBFRDGB-UHFFFAOYSA-N |
| SMILES | C1CC(C(=O)C2=C1C=CC(=C2)[N+](=O)[O-])(F)F |
Computed by PubChem (NCBI)