CAS 6954-64-9 appears in our catalog under these names: N-(2,4-Difluorophenyl)maleamic acid, 95%, (Z)-4-((2,4-Difluorophenyl)amino)-4-oxobut-2-enoic acid, 95+%, N-(2,4-Difluorophenyl)maleamic acid, 98%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 25g, 5g.
(Z)-4-(2,4-difluoroanilino)-4-oxobut-2-enoic acid (CAS 6954-64-9) is a chemical compound with the molecular formula C10H7F2NO3 and a molecular weight of 227.16 g/mol. IUPAC name: (Z)-4-(2,4-difluoroanilino)-4-oxobut-2-enoic acid. InChIKey: DVBSHLGHHLTWPZ-ARJAWSKDSA-N.
| Molecular formula | C10H7F2NO3 |
|---|---|
| Molecular weight | 227.16 g/mol |
| IUPAC name | (Z)-4-(2,4-difluoroanilino)-4-oxobut-2-enoic acid |
| InChIKey | DVBSHLGHHLTWPZ-ARJAWSKDSA-N |
| SMILES | C1=CC(=C(C=C1F)F)NC(=O)/C=C\C(=O)O |
Computed by PubChem (NCBI)