Products 2387595-98-2
CAS 2387595-98-2 is the registry number for 1-(2,6-Difluoro-4-nitrophenyl)cyclopropane-1-carbaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(2,6-difluoro-4-nitrophenyl)cyclopropane-1-carbaldehyde (CAS 2387595-98-2) is a chemical compound with the molecular formula C10H7F2NO3 and a molecular weight of 227.16 g/mol. IUPAC name: 1-(2,6-difluoro-4-nitrophenyl)cyclopropane-1-carbaldehyde. InChIKey: YYTYBQLWTJCEGM-UHFFFAOYSA-N.
| Molecular formula | C10H7F2NO3 |
|---|---|
| Molecular weight | 227.16 g/mol |
| IUPAC name | 1-(2,6-difluoro-4-nitrophenyl)cyclopropane-1-carbaldehyde |
| InChIKey | YYTYBQLWTJCEGM-UHFFFAOYSA-N |
| SMILES | C1CC1(C=O)C2=C(C=C(C=C2F)[N+](=O)[O-])F |
Computed by PubChem (NCBI)