Products 885524-95-8
CAS 885524-95-8 is the registry number for 4-(Difluoromethoxy)-1H-indole-2-carboxylic acid, 98%. Offered by: AmBeed. Available pack sizes: 5g.
4-(difluoromethoxy)-1H-indole-2-carboxylic acid (CAS 885524-95-8) is a chemical compound with the molecular formula C10H7F2NO3 and a molecular weight of 227.16 g/mol. IUPAC name: 4-(difluoromethoxy)-1H-indole-2-carboxylic acid. InChIKey: XGOYZKXAIYPMPZ-UHFFFAOYSA-N.
| Molecular formula | C10H7F2NO3 |
|---|---|
| Molecular weight | 227.16 g/mol |
| IUPAC name | 4-(difluoromethoxy)-1H-indole-2-carboxylic acid |
| InChIKey | XGOYZKXAIYPMPZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(N2)C(=O)O)C(=C1)OC(F)F |
Computed by PubChem (NCBI)