CAS 1164538-71-9 is the registry number for (2E)-4-((2,4-Difluorophenyl)Amino)-4-Oxo-2-Butenoic Acid. Offered by: Biosynth. Available pack sizes: 10mg, 5mg, 25mg.
(E)-4-(2,4-difluoroanilino)-4-oxobut-2-enoic acid (CAS 1164538-71-9) is a chemical compound with the molecular formula C10H7F2NO3 and a molecular weight of 227.16 g/mol. IUPAC name: (E)-4-(2,4-difluoroanilino)-4-oxobut-2-enoic acid. InChIKey: DVBSHLGHHLTWPZ-ONEGZZNKSA-N.
| Molecular formula | C10H7F2NO3 |
|---|---|
| Molecular weight | 227.16 g/mol |
| IUPAC name | (E)-4-(2,4-difluoroanilino)-4-oxobut-2-enoic acid |
| InChIKey | DVBSHLGHHLTWPZ-ONEGZZNKSA-N |
| SMILES | C1=CC(=C(C=C1F)F)NC(=O)/C=C/C(=O)O |
Computed by PubChem (NCBI)