Products 1018250-86-6
CAS 1018250-86-6 is the registry number for 3-Chloro-1-oxo-2-((tetrahydrofuran-2-yl)methyl)-1,2-dihydroisoquinoline-4-carbaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-chloro-1-oxo-2-(oxolan-2-ylmethyl)isoquinoline-4-carbaldehyde (CAS 1018250-86-6) is a chemical compound with the molecular formula C15H14ClNO3 and a molecular weight of 291.73 g/mol. IUPAC name: 3-chloro-1-oxo-2-(oxolan-2-ylmethyl)isoquinoline-4-carbaldehyde. InChIKey: GTJHVRZOCRDFTP-UHFFFAOYSA-N.
| Molecular formula | C15H14ClNO3 |
|---|---|
| Molecular weight | 291.73 g/mol |
| IUPAC name | 3-chloro-1-oxo-2-(oxolan-2-ylmethyl)isoquinoline-4-carbaldehyde |
| InChIKey | GTJHVRZOCRDFTP-UHFFFAOYSA-N |
| SMILES | C1CC(OC1)CN2C(=C(C3=CC=CC=C3C2=O)C=O)Cl |
Computed by PubChem (NCBI)