Products 339297-91-5
CAS 339297-91-5 is the registry number for 4-Chloro-N-(3,4-dimethoxyphenyl)benzamide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 100g.
4-chloro-N-(3,4-dimethoxyphenyl)benzamide (CAS 339297-91-5) is a chemical compound with the molecular formula C15H14ClNO3 and a molecular weight of 291.73 g/mol. IUPAC name: 4-chloro-N-(3,4-dimethoxyphenyl)benzamide. InChIKey: NSACTVLKEQLXTG-UHFFFAOYSA-N.
| Molecular formula | C15H14ClNO3 |
|---|---|
| Molecular weight | 291.73 g/mol |
| IUPAC name | 4-chloro-N-(3,4-dimethoxyphenyl)benzamide |
| InChIKey | NSACTVLKEQLXTG-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)NC(=O)C2=CC=C(C=C2)Cl)OC |
Computed by PubChem (NCBI)