Products 31879-60-4

CAS 31879-60-4 is the registry number for Amoxapine Impurity 4. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Ethyl N-[2-(4-chlorophenoxy)phenyl]carbamate (CAS 31879-60-4) is a chemical compound with the molecular formula C15H14ClNO3 and a molecular weight of 291.73 g/mol. IUPAC name: ethyl N-[2-(4-chlorophenoxy)phenyl]carbamate. InChIKey: IFCZXPPVLLYTEC-UHFFFAOYSA-N.

Identity
Molecular formulaC15H14ClNO3
Molecular weight291.73 g/mol
IUPAC nameethyl N-[2-(4-chlorophenoxy)phenyl]carbamate
InChIKeyIFCZXPPVLLYTEC-UHFFFAOYSA-N
SMILESCCOC(=O)NC1=CC=CC=C1OC2=CC=C(C=C2)Cl

Computed by PubChem (NCBI)