CAS 81051-65-2 appears in our catalog under these names: Karetazan 100 µg/mL in Acetonitrile, Karetazan, >95% (HPLC). Offered by: Dr. Ehrenstorfer, TRC. Available pack sizes: 1ml, 25mg, 50mg, 5mg.
2-(4-chlorophenyl)-1-ethyl-6-methyl-4-oxopyridine-3-carboxylic acid (CAS 81051-65-2) is a chemical compound with the molecular formula C15H14ClNO3 and a molecular weight of 291.73 g/mol. IUPAC name: 2-(4-chlorophenyl)-1-ethyl-6-methyl-4-oxopyridine-3-carboxylic acid. InChIKey: GQFJDWYHPRLNHR-UHFFFAOYSA-N.
| Molecular formula | C15H14ClNO3 |
|---|---|
| Molecular weight | 291.73 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-1-ethyl-6-methyl-4-oxopyridine-3-carboxylic acid |
| InChIKey | GQFJDWYHPRLNHR-UHFFFAOYSA-N |
| SMILES | CCN1C(=CC(=O)C(=C1C2=CC=C(C=C2)Cl)C(=O)O)C |
Computed by PubChem (NCBI)