Products 365542-31-0
CAS 365542-31-0 is the registry number for Methyl (E)-2-hydroxy-6-(2-(pyridin-2-yl)vinyl)benzoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-hydroxy-6-[(E)-2-pyridin-2-ylethenyl]benzoate;hydrochloride (CAS 365542-31-0) is a chemical compound with the molecular formula C15H14ClNO3 and a molecular weight of 291.73 g/mol. IUPAC name: methyl 2-hydroxy-6-[(E)-2-pyridin-2-ylethenyl]benzoate;hydrochloride. InChIKey: PYXWCKDXJMRJBN-HRNDJLQDSA-N.
| Molecular formula | C15H14ClNO3 |
|---|---|
| Molecular weight | 291.73 g/mol |
| IUPAC name | methyl 2-hydroxy-6-[(E)-2-pyridin-2-ylethenyl]benzoate;hydrochloride |
| InChIKey | PYXWCKDXJMRJBN-HRNDJLQDSA-N |
| SMILES | COC(=O)C1=C(C=CC=C1O)/C=C/C2=CC=CC=N2.Cl |
Computed by PubChem (NCBI)