CAS 731003-80-8 is the registry number for 1-(1-(2H-1,3-Benzodioxol-5-yl)-2,5-dimethyl-1H-pyrrol-3-yl)-2-chloroethan-1-one, 95%. Offered by: AmBeed. Available pack sizes: 5g.
1-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-2-chloroethanone (CAS 731003-80-8) is a chemical compound with the molecular formula C15H14ClNO3 and a molecular weight of 291.73 g/mol. IUPAC name: 1-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-2-chloroethanone. InChIKey: DFBQRLUVTMZNAA-UHFFFAOYSA-N.
| Molecular formula | C15H14ClNO3 |
|---|---|
| Molecular weight | 291.73 g/mol |
| IUPAC name | 1-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-2-chloroethanone |
| InChIKey | DFBQRLUVTMZNAA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N1C2=CC3=C(C=C2)OCO3)C)C(=O)CCl |
Computed by PubChem (NCBI)