CAS 1018278-86-8 is the registry number for (4-Aminophenyl)-N-(2-(phenoxy)phenyl)formamide. Offered by: Biosynth. Available pack sizes: 2000mg, 1000mg, 5000mg, 10000mg.
4-amino-N-(2-phenoxyphenyl)benzamide (CAS 1018278-86-8) is a chemical compound with the molecular formula C19H16N2O2 and a molecular weight of 304.3 g/mol. IUPAC name: 4-amino-N-(2-phenoxyphenyl)benzamide. InChIKey: BQTUWYHSNUOUSO-UHFFFAOYSA-N.
| Molecular formula | C19H16N2O2 |
|---|---|
| Molecular weight | 304.3 g/mol |
| IUPAC name | 4-amino-N-(2-phenoxyphenyl)benzamide |
| InChIKey | BQTUWYHSNUOUSO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=CC=C2NC(=O)C3=CC=C(C=C3)N |
Computed by PubChem (NCBI)