CAS 1018451-10-9 is the registry number for 2,4-Dimethoxy-3-fluorobenzoic acid, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 5g.
3-fluoro-2,4-dimethoxybenzoic acid (CAS 1018451-10-9) is a chemical compound with the molecular formula C9H9FO4 and a molecular weight of 200.16 g/mol. IUPAC name: 3-fluoro-2,4-dimethoxybenzoic acid. InChIKey: YDGFFRLWOROFMN-UHFFFAOYSA-N.
| Molecular formula | C9H9FO4 |
|---|---|
| Molecular weight | 200.16 g/mol |
| IUPAC name | 3-fluoro-2,4-dimethoxybenzoic acid |
| InChIKey | YDGFFRLWOROFMN-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)C(=O)O)OC)F |
Computed by PubChem (NCBI)