CAS 1018497-10-3 appears in our catalog under these names: 3-Amino-5-ethyl-6-methyl-1H,4H,5H-pyrazolo(4,3-c)pyridin-4-one, 95%, 3-Amino-5-ethyl-6-methyl-1H,4H,5H-pyrazolo(4,3-c)pyridin-4-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
3-amino-5-ethyl-6-methyl-1H-pyrazolo[4,3-c]pyridin-4-one (CAS 1018497-10-3) is a chemical compound with the molecular formula C9H12N4O and a molecular weight of 192.22 g/mol. IUPAC name: 3-amino-5-ethyl-6-methyl-1H-pyrazolo[4,3-c]pyridin-4-one. InChIKey: YNYLEBVEZMVHFJ-UHFFFAOYSA-N.
| Molecular formula | C9H12N4O |
|---|---|
| Molecular weight | 192.22 g/mol |
| IUPAC name | 3-amino-5-ethyl-6-methyl-1H-pyrazolo[4,3-c]pyridin-4-one |
| InChIKey | YNYLEBVEZMVHFJ-UHFFFAOYSA-N |
| SMILES | CCN1C(=CC2=C(C1=O)C(=NN2)N)C |
Computed by PubChem (NCBI)