Products 1018559-05-1
CAS 1018559-05-1 is the registry number for 1-(6-Amino-2,3-dihydro-1H-indol-1-yl)-2-phenylethan-1-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-(6-amino-2,3-dihydroindol-1-yl)-2-phenylethanone (CAS 1018559-05-1) is a chemical compound with the molecular formula C16H16N2O and a molecular weight of 252.31 g/mol. IUPAC name: 1-(6-amino-2,3-dihydroindol-1-yl)-2-phenylethanone. InChIKey: CBZXIRGLROWODV-UHFFFAOYSA-N.
| Molecular formula | C16H16N2O |
|---|---|
| Molecular weight | 252.31 g/mol |
| IUPAC name | 1-(6-amino-2,3-dihydroindol-1-yl)-2-phenylethanone |
| InChIKey | CBZXIRGLROWODV-UHFFFAOYSA-N |
| SMILES | C1CN(C2=C1C=CC(=C2)N)C(=O)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)