CAS 101870-68-2 is the registry number for 2,3-Dichloro-5-methoxyquinoxaline 95+%. Offered by: Ambeed. Available pack sizes: 250mg, 1g, 5g.
2,3-dichloro-5-methoxyquinoxaline (CAS 101870-68-2) is a chemical compound with the molecular formula C9H6Cl2N2O and a molecular weight of 229.06 g/mol. IUPAC name: 2,3-dichloro-5-methoxyquinoxaline. InChIKey: IWWDZAKTAZHJNP-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2N2O |
|---|---|
| Molecular weight | 229.06 g/mol |
| IUPAC name | 2,3-dichloro-5-methoxyquinoxaline |
| InChIKey | IWWDZAKTAZHJNP-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC2=C1N=C(C(=N2)Cl)Cl |
Computed by PubChem (NCBI)