CAS 1956377-40-4 is the registry number for 5-Acetyl-2-bromobenzoic acid isopropyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 1g.
Propan-2-yl 5-acetyl-2-bromobenzoate (CAS 1956377-40-4) is a chemical compound with the molecular formula C12H13BrO3 and a molecular weight of 285.13 g/mol. IUPAC name: propan-2-yl 5-acetyl-2-bromobenzoate. InChIKey: BSBBZQIGACRXKZ-UHFFFAOYSA-N.
| Molecular formula | C12H13BrO3 |
|---|---|
| Molecular weight | 285.13 g/mol |
| IUPAC name | propan-2-yl 5-acetyl-2-bromobenzoate |
| InChIKey | BSBBZQIGACRXKZ-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)C1=C(C=CC(=C1)C(=O)C)Br |
Computed by PubChem (NCBI)