Products 1019008-49-1
CAS 1019008-49-1 is the registry number for 1-(4-Methoxyphenyl)-3-phenyl-1H-pyrazole-5-carbonyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(4-methoxyphenyl)-3-phenylpyrazole-5-carbonyl chloride (CAS 1019008-49-1) is a chemical compound with the molecular formula C17H13ClN2O2 and a molecular weight of 312.7 g/mol. IUPAC name: 1-(4-methoxyphenyl)-3-phenylpyrazole-5-carbonyl chloride. InChIKey: PTZHBCWTUQXMKP-UHFFFAOYSA-N.
| Molecular formula | C17H13ClN2O2 |
|---|---|
| Molecular weight | 312.7 g/mol |
| IUPAC name | 1-(4-methoxyphenyl)-3-phenylpyrazole-5-carbonyl chloride |
| InChIKey | PTZHBCWTUQXMKP-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)N2C(=CC(=N2)C3=CC=CC=C3)C(=O)Cl |
Computed by PubChem (NCBI)