CAS 618102-10-6 is the registry number for 1-(4-Chlorophenyl)-3-(4-methylphenyl)-1H-pyrazole-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 500mg, 250mg, 1000mg.
1-(4-chlorophenyl)-3-(4-methylphenyl)pyrazole-5-carboxylic acid (CAS 618102-10-6) is a chemical compound with the molecular formula C17H13ClN2O2 and a molecular weight of 312.7 g/mol. IUPAC name: 1-(4-chlorophenyl)-3-(4-methylphenyl)pyrazole-5-carboxylic acid. InChIKey: MFDZVWYHGSJHSG-UHFFFAOYSA-N.
| Molecular formula | C17H13ClN2O2 |
|---|---|
| Molecular weight | 312.7 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-3-(4-methylphenyl)pyrazole-5-carboxylic acid |
| InChIKey | MFDZVWYHGSJHSG-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NN(C(=C2)C(=O)O)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)