Products 1148126-04-8
CAS 1148126-04-8 appears in our catalog under these names: DHODH–IN–3, DHODH-IN-3. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, Get quote.
(Z)-N-(2-chloro-4-phenylphenyl)-2-cyano-3-hydroxybut-2-enamide (CAS 1148126-04-8) is a chemical compound with the molecular formula C17H13ClN2O2 and a molecular weight of 312.7 g/mol. IUPAC name: (Z)-N-(2-chloro-4-phenylphenyl)-2-cyano-3-hydroxybut-2-enamide. InChIKey: OVZOHAXVUVNPQF-KAMYIIQDSA-N.
| Molecular formula | C17H13ClN2O2 |
|---|---|
| Molecular weight | 312.7 g/mol |
| IUPAC name | (Z)-N-(2-chloro-4-phenylphenyl)-2-cyano-3-hydroxybut-2-enamide |
| InChIKey | OVZOHAXVUVNPQF-KAMYIIQDSA-N |
| SMILES | C/C(=C(\C#N)/C(=O)NC1=C(C=C(C=C1)C2=CC=CC=C2)Cl)/O |
Computed by PubChem (NCBI)