Products 67728-26-1
CAS 67728-26-1 is the registry number for N-(4-Amino-2-chlorophenyl)-1-hydroxy-2-naphthamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(4-amino-2-chlorophenyl)-1-hydroxynaphthalene-2-carboxamide (CAS 67728-26-1) is a chemical compound with the molecular formula C17H13ClN2O2 and a molecular weight of 312.7 g/mol. IUPAC name: N-(4-amino-2-chlorophenyl)-1-hydroxynaphthalene-2-carboxamide. InChIKey: WCILLABDKIZPNK-UHFFFAOYSA-N.
| Molecular formula | C17H13ClN2O2 |
|---|---|
| Molecular weight | 312.7 g/mol |
| IUPAC name | N-(4-amino-2-chlorophenyl)-1-hydroxynaphthalene-2-carboxamide |
| InChIKey | WCILLABDKIZPNK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=C2O)C(=O)NC3=C(C=C(C=C3)N)Cl |
Computed by PubChem (NCBI)