CAS 956199-29-4 is the registry number for 1-((2-Chlorophenyl)methyl)-3-phenyl-1H-pyrazole-4-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
1-[(2-chlorophenyl)methyl]-3-phenylpyrazole-4-carboxylic acid (CAS 956199-29-4) is a chemical compound with the molecular formula C17H13ClN2O2 and a molecular weight of 312.7 g/mol. IUPAC name: 1-[(2-chlorophenyl)methyl]-3-phenylpyrazole-4-carboxylic acid. InChIKey: PPWSYOXTAUSOMB-UHFFFAOYSA-N.
| Molecular formula | C17H13ClN2O2 |
|---|---|
| Molecular weight | 312.7 g/mol |
| IUPAC name | 1-[(2-chlorophenyl)methyl]-3-phenylpyrazole-4-carboxylic acid |
| InChIKey | PPWSYOXTAUSOMB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN(C=C2C(=O)O)CC3=CC=CC=C3Cl |
Computed by PubChem (NCBI)