Products 1020236-01-4
CAS 1020236-01-4 is the registry number for 1-Benzyl-5-(4-chlorophenyl)-1H-pyrazole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 500mg, 250mg.
1-benzyl-5-(4-chlorophenyl)pyrazole-3-carboxylic acid (CAS 1020236-01-4) is a chemical compound with the molecular formula C17H13ClN2O2 and a molecular weight of 312.7 g/mol. IUPAC name: 1-benzyl-5-(4-chlorophenyl)pyrazole-3-carboxylic acid. InChIKey: GUYHUCPHAZNXCB-UHFFFAOYSA-N.
| Molecular formula | C17H13ClN2O2 |
|---|---|
| Molecular weight | 312.7 g/mol |
| IUPAC name | 1-benzyl-5-(4-chlorophenyl)pyrazole-3-carboxylic acid |
| InChIKey | GUYHUCPHAZNXCB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C(=CC(=N2)C(=O)O)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)