Products 1019018-84-8
CAS 1019018-84-8 is the registry number for 2-Bromo-5-chloro-4-fluorobenzenesulfonyl chloride. Offered by: Fluorochem. Available pack sizes: 250mg, 1g, 5g.
2-bromo-5-chloro-4-fluorobenzenesulfonyl chloride (CAS 1019018-84-8) is a chemical compound with the molecular formula C6H2BrCl2FO2S and a molecular weight of 307.95 g/mol. IUPAC name: 2-bromo-5-chloro-4-fluorobenzenesulfonyl chloride. InChIKey: XOEKZCDMEXEEAI-UHFFFAOYSA-N.
| Molecular formula | C6H2BrCl2FO2S |
|---|---|
| Molecular weight | 307.95 g/mol |
| IUPAC name | 2-bromo-5-chloro-4-fluorobenzenesulfonyl chloride |
| InChIKey | XOEKZCDMEXEEAI-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Br)S(=O)(=O)Cl)Cl)F |
Computed by PubChem (NCBI)