Products 1208075-41-5

CAS 1208075-41-5 appears in our catalog under these names: 4-Bromo-5-chloro-2-fluorobenzenesulfonyl chloride, 4-Bromo-5-chloro-2-fluorobenzene-1-sulfonyl chloride 97%. Offered by: Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

4-bromo-5-chloro-2-fluorobenzenesulfonyl chloride (CAS 1208075-41-5) is a chemical compound with the molecular formula C6H2BrCl2FO2S and a molecular weight of 307.95 g/mol. IUPAC name: 4-bromo-5-chloro-2-fluorobenzenesulfonyl chloride. InChIKey: VNPRKBFETGIANP-UHFFFAOYSA-N.

Identity
Molecular formulaC6H2BrCl2FO2S
Molecular weight307.95 g/mol
IUPAC name4-bromo-5-chloro-2-fluorobenzenesulfonyl chloride
InChIKeyVNPRKBFETGIANP-UHFFFAOYSA-N
SMILESC1=C(C(=CC(=C1Br)Cl)S(=O)(=O)Cl)F

Computed by PubChem (NCBI)