CAS 874801-47-5 appears in our catalog under these names: 2-Bromo-4-chloro-5-fluorobenzenesulfonyl chloride, 95%, 2-Bromo-4-chloro-5-fluorobenzenesulfonyl chloride, 98%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 25g.
2-bromo-4-chloro-5-fluorobenzenesulfonyl chloride (CAS 874801-47-5) is a chemical compound with the molecular formula C6H2BrCl2FO2S and a molecular weight of 307.95 g/mol. IUPAC name: 2-bromo-4-chloro-5-fluorobenzenesulfonyl chloride. InChIKey: RQBUYKWEMDXLCL-UHFFFAOYSA-N.
| Molecular formula | C6H2BrCl2FO2S |
|---|---|
| Molecular weight | 307.95 g/mol |
| IUPAC name | 2-bromo-4-chloro-5-fluorobenzenesulfonyl chloride |
| InChIKey | RQBUYKWEMDXLCL-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1S(=O)(=O)Cl)Br)Cl)F |
Computed by PubChem (NCBI)