Products 1070972-67-6

CAS 1070972-67-6 appears in our catalog under these names: 5-Bromo-4-chloro-2-fluoro-benzenesulfonyl chloride, 97%, 5-Bromo-4-Chloro-2-fluorobenzene-1-sulfonyl chloride 97%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 10g, 5g, 1g, 25g.

Structural formula: {0} (CAS {1})

5-bromo-4-chloro-2-fluorobenzenesulfonyl chloride (CAS 1070972-67-6) is a chemical compound with the molecular formula C6H2BrCl2FO2S and a molecular weight of 307.95 g/mol. IUPAC name: 5-bromo-4-chloro-2-fluorobenzenesulfonyl chloride. InChIKey: PXPORJQFAPJYFL-UHFFFAOYSA-N.

Identity
Molecular formulaC6H2BrCl2FO2S
Molecular weight307.95 g/mol
IUPAC name5-bromo-4-chloro-2-fluorobenzenesulfonyl chloride
InChIKeyPXPORJQFAPJYFL-UHFFFAOYSA-N
SMILESC1=C(C(=CC(=C1Cl)Br)S(=O)(=O)Cl)F

Computed by PubChem (NCBI)