Products 1123307-06-1
CAS 1123307-06-1 appears in our catalog under these names: 5-Bromo-2-chloro-4-fluorobenzenesulfonyl chloride, 95%, 5-Bromo-2-chloro-4-fluorobenzene-1-sulfonyl chloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 10g, 1g, 50mg, 0,5g.
5-bromo-2-chloro-4-fluorobenzenesulfonyl chloride (CAS 1123307-06-1) is a chemical compound with the molecular formula C6H2BrCl2FO2S and a molecular weight of 307.95 g/mol. IUPAC name: 5-bromo-2-chloro-4-fluorobenzenesulfonyl chloride. InChIKey: GSWQETLVQGFCBU-UHFFFAOYSA-N.
| Molecular formula | C6H2BrCl2FO2S |
|---|---|
| Molecular weight | 307.95 g/mol |
| IUPAC name | 5-bromo-2-chloro-4-fluorobenzenesulfonyl chloride |
| InChIKey | GSWQETLVQGFCBU-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)S(=O)(=O)Cl)Br)F |
Computed by PubChem (NCBI)