Products 2386140-42-5
CAS 2386140-42-5 is the registry number for 4-Bromo-2-chloro-3-fluorobenzenesulfonyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-bromo-2-chloro-3-fluorobenzenesulfonyl chloride (CAS 2386140-42-5) is a chemical compound with the molecular formula C6H2BrCl2FO2S and a molecular weight of 307.95 g/mol. IUPAC name: 4-bromo-2-chloro-3-fluorobenzenesulfonyl chloride. InChIKey: PZUKXAPAFMJIAR-UHFFFAOYSA-N.
| Molecular formula | C6H2BrCl2FO2S |
|---|---|
| Molecular weight | 307.95 g/mol |
| IUPAC name | 4-bromo-2-chloro-3-fluorobenzenesulfonyl chloride |
| InChIKey | PZUKXAPAFMJIAR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1S(=O)(=O)Cl)Cl)F)Br |
Computed by PubChem (NCBI)