CAS 1019357-51-7 is the registry number for 2-((2,5-Dichlorophenyl)amino)nicotinonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g, 25g.
2-(2,5-dichloroanilino)pyridine-3-carbonitrile (CAS 1019357-51-7) is a chemical compound with the molecular formula C12H7Cl2N3 and a molecular weight of 264.11 g/mol. IUPAC name: 2-(2,5-dichloroanilino)pyridine-3-carbonitrile. InChIKey: FOBDOMCVNBTSBL-UHFFFAOYSA-N.
| Molecular formula | C12H7Cl2N3 |
|---|---|
| Molecular weight | 264.11 g/mol |
| IUPAC name | 2-(2,5-dichloroanilino)pyridine-3-carbonitrile |
| InChIKey | FOBDOMCVNBTSBL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)NC2=C(C=CC(=C2)Cl)Cl)C#N |
Computed by PubChem (NCBI)