Products 237435-80-2

CAS 237435-80-2 is the registry number for 2,4-Dichloro-6-phenyl-5H-pyrrolo[3,2-d]pyrimidine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

2,4-dichloro-6-phenyl-5H-pyrrolo[3,2-d]pyrimidine (CAS 237435-80-2) is a chemical compound with the molecular formula C12H7Cl2N3 and a molecular weight of 264.11 g/mol. IUPAC name: 2,4-dichloro-6-phenyl-5H-pyrrolo[3,2-d]pyrimidine. InChIKey: RSYBVSVLBSDACE-UHFFFAOYSA-N.

Identity
Molecular formulaC12H7Cl2N3
Molecular weight264.11 g/mol
IUPAC name2,4-dichloro-6-phenyl-5H-pyrrolo[3,2-d]pyrimidine
InChIKeyRSYBVSVLBSDACE-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C2=CC3=C(N2)C(=NC(=N3)Cl)Cl

Computed by PubChem (NCBI)