CAS 1550030-58-4 is the registry number for 6,8-Dichloro-2-(pyridin-2-yl)imidazo[1,2-a]pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6,8-dichloro-2-pyridin-2-ylimidazo[1,2-a]pyridine (CAS 1550030-58-4) is a chemical compound with the molecular formula C12H7Cl2N3 and a molecular weight of 264.11 g/mol. IUPAC name: 6,8-dichloro-2-pyridin-2-ylimidazo[1,2-a]pyridine. InChIKey: QDQFGEOKZLLGCK-UHFFFAOYSA-N.
| Molecular formula | C12H7Cl2N3 |
|---|---|
| Molecular weight | 264.11 g/mol |
| IUPAC name | 6,8-dichloro-2-pyridin-2-ylimidazo[1,2-a]pyridine |
| InChIKey | QDQFGEOKZLLGCK-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=CN3C=C(C=C(C3=N2)Cl)Cl |
Computed by PubChem (NCBI)