Products 77712-91-5
CAS 77712-91-5 is the registry number for 4-Chloro-2-(2-chlorophenyl)-1h-imidazo[4,5-c]pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
4-chloro-2-(2-chlorophenyl)-1H-imidazo[4,5-c]pyridine (CAS 77712-91-5) is a chemical compound with the molecular formula C12H7Cl2N3 and a molecular weight of 264.11 g/mol. IUPAC name: 4-chloro-2-(2-chlorophenyl)-1H-imidazo[4,5-c]pyridine. InChIKey: NGCHWEIPUJGEFX-UHFFFAOYSA-N.
| Molecular formula | C12H7Cl2N3 |
|---|---|
| Molecular weight | 264.11 g/mol |
| IUPAC name | 4-chloro-2-(2-chlorophenyl)-1H-imidazo[4,5-c]pyridine |
| InChIKey | NGCHWEIPUJGEFX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC3=C(N2)C=CN=C3Cl)Cl |
Computed by PubChem (NCBI)