CAS 1025065-97-7 is the registry number for 6-Chloro-3-(4-chlorophenyl)imidazo[1,2-b]pyridazine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
6-chloro-3-(4-chlorophenyl)imidazo[1,2-b]pyridazine (CAS 1025065-97-7) is a chemical compound with the molecular formula C12H7Cl2N3 and a molecular weight of 264.11 g/mol. IUPAC name: 6-chloro-3-(4-chlorophenyl)imidazo[1,2-b]pyridazine. InChIKey: OXJWEVLKAMUKSA-UHFFFAOYSA-N.
| Molecular formula | C12H7Cl2N3 |
|---|---|
| Molecular weight | 264.11 g/mol |
| IUPAC name | 6-chloro-3-(4-chlorophenyl)imidazo[1,2-b]pyridazine |
| InChIKey | OXJWEVLKAMUKSA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CN=C3N2N=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)