CAS 1638768-42-9 is the registry number for 2-(2,6-Dichlorophenyl)imidazo[1,2-c]pyrimidine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2,6-dichlorophenyl)imidazo[1,2-c]pyrimidine (CAS 1638768-42-9) is a chemical compound with the molecular formula C12H7Cl2N3 and a molecular weight of 264.11 g/mol. IUPAC name: 2-(2,6-dichlorophenyl)imidazo[1,2-c]pyrimidine. InChIKey: IESSENBAEUCGDQ-UHFFFAOYSA-N.
| Molecular formula | C12H7Cl2N3 |
|---|---|
| Molecular weight | 264.11 g/mol |
| IUPAC name | 2-(2,6-dichlorophenyl)imidazo[1,2-c]pyrimidine |
| InChIKey | IESSENBAEUCGDQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)C2=CN3C=NC=CC3=N2)Cl |
Computed by PubChem (NCBI)