Products 1019451-16-1
CAS 1019451-16-1 is the registry number for 6-(2,3-Dichlorophenoxy)pyridine-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
6-(2,3-dichlorophenoxy)pyridine-3-carboxylic acid (CAS 1019451-16-1) is a chemical compound with the molecular formula C12H7Cl2NO3 and a molecular weight of 284.09 g/mol. IUPAC name: 6-(2,3-dichlorophenoxy)pyridine-3-carboxylic acid. InChIKey: QHWZEPWFSIPEBN-UHFFFAOYSA-N.
| Molecular formula | C12H7Cl2NO3 |
|---|---|
| Molecular weight | 284.09 g/mol |
| IUPAC name | 6-(2,3-dichlorophenoxy)pyridine-3-carboxylic acid |
| InChIKey | QHWZEPWFSIPEBN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)OC2=NC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)